CAS 1019363-62-2 appears in our catalog under these names: 3-Chloro-2-(pyridin-2-ylsulfanyl)aniline, 3-Chloro-2-(pyridin-2-ylsulfanyl)aniline, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 10g.
3-chloro-2-pyridin-2-ylsulfanylaniline (CAS 1019363-62-2) is a chemical compound with the molecular formula C11H9ClN2S and a molecular weight of 236.72 g/mol. IUPAC name: 3-chloro-2-pyridin-2-ylsulfanylaniline. InChIKey: QECVIIDKHSLJPR-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2S |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | 3-chloro-2-pyridin-2-ylsulfanylaniline |
| InChIKey | QECVIIDKHSLJPR-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)SC2=C(C=CC=C2Cl)N |
Computed by PubChem (NCBI)