CAS 263276-30-8 appears in our catalog under these names: 4-(Benzylsulfanyl)-6-chloropyrimidine, 95%, 4-(Benzylsulfanyl)-6-chloropyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
4-benzylsulfanyl-6-chloropyrimidine (CAS 263276-30-8) is a chemical compound with the molecular formula C11H9ClN2S and a molecular weight of 236.72 g/mol. IUPAC name: 4-benzylsulfanyl-6-chloropyrimidine. InChIKey: RTJMTMHZRUDVBK-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2S |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | 4-benzylsulfanyl-6-chloropyrimidine |
| InChIKey | RTJMTMHZRUDVBK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=CC(=NC=N2)Cl |
Computed by PubChem (NCBI)