CAS 1019391-52-6 appears in our catalog under these names: 3-Chloro-4-((4-methyl-1,3-thiazol-2-yl)sulfanyl)aniline, 95%, 3-Chloro-4-((4-methyl-1,3-thiazol-2-yl)sulfanyl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
3-chloro-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline (CAS 1019391-52-6) is a chemical compound with the molecular formula C10H9ClN2S2 and a molecular weight of 256.8 g/mol. IUPAC name: 3-chloro-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline. InChIKey: BRIOHPWVNABADU-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2S2 |
|---|---|
| Molecular weight | 256.8 g/mol |
| IUPAC name | 3-chloro-4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]aniline |
| InChIKey | BRIOHPWVNABADU-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)SC2=C(C=C(C=C2)N)Cl |
Computed by PubChem (NCBI)