CAS 1803600-55-6 appears in our catalog under these names: 3-Chloro-5-{((4-methylphenyl)methyl)sulfanyl}-1,2,4-thiadiazole, 95%, 3-Chloro-5-{((4-methylphenyl)methyl)sulfanyl}-1,2,4-thiadiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-chloro-5-[(4-methylphenyl)methylsulfanyl]-1,2,4-thiadiazole (CAS 1803600-55-6) is a chemical compound with the molecular formula C10H9ClN2S2 and a molecular weight of 256.8 g/mol. IUPAC name: 3-chloro-5-[(4-methylphenyl)methylsulfanyl]-1,2,4-thiadiazole. InChIKey: HRNCHOSCMMKGJC-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2S2 |
|---|---|
| Molecular weight | 256.8 g/mol |
| IUPAC name | 3-chloro-5-[(4-methylphenyl)methylsulfanyl]-1,2,4-thiadiazole |
| InChIKey | HRNCHOSCMMKGJC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CSC2=NC(=NS2)Cl |
Computed by PubChem (NCBI)