Products 1019396-10-1
CAS 1019396-10-1 is the registry number for Ethyl 6-bromo-4,8-dichloroquinoline-3-carboxylate. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
Ethyl 6-bromo-4,8-dichloroquinoline-3-carboxylate (CAS 1019396-10-1) is a chemical compound with the molecular formula C12H8BrCl2NO2 and a molecular weight of 349.00 g/mol. IUPAC name: ethyl 6-bromo-4,8-dichloroquinoline-3-carboxylate. InChIKey: PBEWDGPPZOIINM-UHFFFAOYSA-N.
| Molecular formula | C12H8BrCl2NO2 |
|---|---|
| Molecular weight | 349.00 g/mol |
| IUPAC name | ethyl 6-bromo-4,8-dichloroquinoline-3-carboxylate |
| InChIKey | PBEWDGPPZOIINM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2C(=CC(=CC2=C1Cl)Br)Cl |
Computed by PubChem (NCBI)