Products 1019498-56-6
CAS 1019498-56-6 is the registry number for 1-Cyclobutanecarbonyl-2,3-dihydro-1h-indol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(5-amino-2,3-dihydroindol-1-yl)-cyclobutylmethanone (CAS 1019498-56-6) is a chemical compound with the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. IUPAC name: (5-amino-2,3-dihydroindol-1-yl)-cyclobutylmethanone. InChIKey: NMGBFBASIMUYKW-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | (5-amino-2,3-dihydroindol-1-yl)-cyclobutylmethanone |
| InChIKey | NMGBFBASIMUYKW-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C(=O)N2CCC3=C2C=CC(=C3)N |
Computed by PubChem (NCBI)