CAS 1019564-99-8 appears in our catalog under these names: (Pyridin-2-ylmethyl)({(3-(trifluoromethyl)phenyl)methyl})amine, 95%, (Pyridin-2-ylmethyl)({(3-(trifluoromethyl)phenyl)methyl})amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
N-(pyridin-2-ylmethyl)-1-[3-(trifluoromethyl)phenyl]methanamine (CAS 1019564-99-8) is a chemical compound with the molecular formula C14H13F3N2 and a molecular weight of 266.26 g/mol. IUPAC name: N-(pyridin-2-ylmethyl)-1-[3-(trifluoromethyl)phenyl]methanamine. InChIKey: PMSIFDQDPDIBIG-UHFFFAOYSA-N.
| Molecular formula | C14H13F3N2 |
|---|---|
| Molecular weight | 266.26 g/mol |
| IUPAC name | N-(pyridin-2-ylmethyl)-1-[3-(trifluoromethyl)phenyl]methanamine |
| InChIKey | PMSIFDQDPDIBIG-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CNCC2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)