CAS 2732520-89-5 is the registry number for 4-(Aminomethyl)-N-(2,4-difluorobenzyl)-3-fluoroaniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(aminomethyl)-N-[(2,4-difluorophenyl)methyl]-3-fluoroaniline (CAS 2732520-89-5) is a chemical compound with the molecular formula C14H13F3N2 and a molecular weight of 266.26 g/mol. IUPAC name: 4-(aminomethyl)-N-[(2,4-difluorophenyl)methyl]-3-fluoroaniline. InChIKey: KCEDTIDUKSNEAB-UHFFFAOYSA-N.
| Molecular formula | C14H13F3N2 |
|---|---|
| Molecular weight | 266.26 g/mol |
| IUPAC name | 4-(aminomethyl)-N-[(2,4-difluorophenyl)methyl]-3-fluoroaniline |
| InChIKey | KCEDTIDUKSNEAB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NCC2=C(C=C(C=C2)F)F)F)CN |
Computed by PubChem (NCBI)