CAS 1019602-10-8 appears in our catalog under these names: 2-(1-Aminoethyl)-4-fluoro-N,N-dimethylaniline, 95%, 2-(1-Aminoethyl)-4-fluoro-N,N-dimethylaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-(1-aminoethyl)-4-fluoro-N,N-dimethylaniline (CAS 1019602-10-8) is a chemical compound with the molecular formula C10H15FN2 and a molecular weight of 182.24 g/mol. IUPAC name: 2-(1-aminoethyl)-4-fluoro-N,N-dimethylaniline. InChIKey: AXTDJCWTDXAMFC-UHFFFAOYSA-N.
| Molecular formula | C10H15FN2 |
|---|---|
| Molecular weight | 182.24 g/mol |
| IUPAC name | 2-(1-aminoethyl)-4-fluoro-N,N-dimethylaniline |
| InChIKey | AXTDJCWTDXAMFC-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC(=C1)F)N(C)C)N |
Computed by PubChem (NCBI)