CAS 1146290-08-5 appears in our catalog under these names: 2-Fluoro-1-N-methyl-1-N-(propan-2-yl)benzene-1,4-diamine, 95%, 2-Fluoro-1-N-methyl-1-N-(propan-2-yl)benzene-1,4-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-fluoro-1-N-methyl-1-N-propan-2-ylbenzene-1,4-diamine (CAS 1146290-08-5) is a chemical compound with the molecular formula C10H15FN2 and a molecular weight of 182.24 g/mol. IUPAC name: 2-fluoro-1-N-methyl-1-N-propan-2-ylbenzene-1,4-diamine. InChIKey: VZEPGKZUGJQACX-UHFFFAOYSA-N.
| Molecular formula | C10H15FN2 |
|---|---|
| Molecular weight | 182.24 g/mol |
| IUPAC name | 2-fluoro-1-N-methyl-1-N-propan-2-ylbenzene-1,4-diamine |
| InChIKey | VZEPGKZUGJQACX-UHFFFAOYSA-N |
| SMILES | CC(C)N(C)C1=C(C=C(C=C1)N)F |
Computed by PubChem (NCBI)