CAS 1019650-80-6 appears in our catalog under these names: 2-Pyrrolidinone, 4-(3-methylphenyl), 95%, 4-(m-tolyl)Pyrrolidin-2-one, 95+%, 4-(3-Methylphenyl)pyrrolidin-2-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 50mg, 0,5g.
4-(3-methylphenyl)pyrrolidin-2-one (CAS 1019650-80-6) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 4-(3-methylphenyl)pyrrolidin-2-one. InChIKey: JDNVNVFAFWJZAZ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 4-(3-methylphenyl)pyrrolidin-2-one |
| InChIKey | JDNVNVFAFWJZAZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2CC(=O)NC2 |
Computed by PubChem (NCBI)