Products 1020-16-2

CAS 1020-16-2 is the registry number for 3-(4-Morpholino)propiophenone hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.

Structural formula: {0} (CAS {1})

3-morpholin-4-yl-1-phenylpropan-1-one;hydrochloride (CAS 1020-16-2) is a chemical compound with the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. IUPAC name: 3-morpholin-4-yl-1-phenylpropan-1-one;hydrochloride. InChIKey: BEUAFINDWSQCGS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18ClNO2
Molecular weight255.74 g/mol
IUPAC name3-morpholin-4-yl-1-phenylpropan-1-one;hydrochloride
InChIKeyBEUAFINDWSQCGS-UHFFFAOYSA-N
SMILESC1COCCN1CCC(=O)C2=CC=CC=C2.Cl

Computed by PubChem (NCBI)