CAS 1020043-28-0 appears in our catalog under these names: 4-Benzyl-3-chloro-5-phenyl-4H-1,2,4-triazole, 95%, 4-Benzyl-3-chloro-5-phenyl-4H-1,2,4-triazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
4-benzyl-3-chloro-5-phenyl-1,2,4-triazole (CAS 1020043-28-0) is a chemical compound with the molecular formula C15H12ClN3 and a molecular weight of 269.73 g/mol. IUPAC name: 4-benzyl-3-chloro-5-phenyl-1,2,4-triazole. InChIKey: MYRBSCDFIIDPDV-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN3 |
|---|---|
| Molecular weight | 269.73 g/mol |
| IUPAC name | 4-benzyl-3-chloro-5-phenyl-1,2,4-triazole |
| InChIKey | MYRBSCDFIIDPDV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=NN=C2Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)