Products 67438-99-7
CAS 67438-99-7 is the registry number for 4-(4-chlorophenyl)-2,6-dimethyl-1,4-dihydro-3,5-pyridinedicarbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-(4-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarbonitrile (CAS 67438-99-7) is a chemical compound with the molecular formula C15H12ClN3 and a molecular weight of 269.73 g/mol. IUPAC name: 4-(4-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarbonitrile. InChIKey: JVBZMCLWKAGQDJ-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN3 |
|---|---|
| Molecular weight | 269.73 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarbonitrile |
| InChIKey | JVBZMCLWKAGQDJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C#N)C2=CC=C(C=C2)Cl)C#N |
Computed by PubChem (NCBI)