CAS 102014-39-1 is the registry number for Policresulen Impurity 12. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
5-hydroxy-2-methylbenzenesulfonic acid (CAS 102014-39-1) is a chemical compound with the molecular formula C7H8O4S and a molecular weight of 188.20 g/mol. IUPAC name: 5-hydroxy-2-methylbenzenesulfonic acid. InChIKey: YWHXPJLWNXLVHP-UHFFFAOYSA-N.
| Molecular formula | C7H8O4S |
|---|---|
| Molecular weight | 188.20 g/mol |
| IUPAC name | 5-hydroxy-2-methylbenzenesulfonic acid |
| InChIKey | YWHXPJLWNXLVHP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)O)S(=O)(=O)O |
Computed by PubChem (NCBI)