Products 7134-05-6

CAS 7134-05-6 appears in our catalog under these names: Policresulen Impurity 7, Policresulen Impurity 2. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

4-hydroxy-2-methylbenzenesulfonic acid (CAS 7134-05-6) is a chemical compound with the molecular formula C7H8O4S and a molecular weight of 188.20 g/mol. IUPAC name: 4-hydroxy-2-methylbenzenesulfonic acid. InChIKey: PYPXOMYXFFYJIF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8O4S
Molecular weight188.20 g/mol
IUPAC name4-hydroxy-2-methylbenzenesulfonic acid
InChIKeyPYPXOMYXFFYJIF-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)O)S(=O)(=O)O

Computed by PubChem (NCBI)