CAS 1020252-01-0 is the registry number for 2-(((2-methyl-4-quinolyl)amino)ethylidene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
3-hydroxy-2-[C-methyl-N-(2-methylquinolin-4-yl)carbonimidoyl]inden-1-one (CAS 1020252-01-0) is a chemical compound with the molecular formula C21H16N2O2 and a molecular weight of 328.4 g/mol. IUPAC name: 3-hydroxy-2-[C-methyl-N-(2-methylquinolin-4-yl)carbonimidoyl]inden-1-one. InChIKey: PGZFNYXHVQCENG-UHFFFAOYSA-N.
| Molecular formula | C21H16N2O2 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 3-hydroxy-2-[C-methyl-N-(2-methylquinolin-4-yl)carbonimidoyl]inden-1-one |
| InChIKey | PGZFNYXHVQCENG-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC=C2C(=C1)N=C(C)C3=C(C4=CC=CC=C4C3=O)O |
Computed by PubChem (NCBI)