CAS 12769-16-3 appears in our catalog under these names: C.I. Solvent blue 19, 1 g, 1-(Methylamino)-4-(phenylamino)anthracene-9,10-dione, 95+%, C.I. Solvent blue 19, 1-(Methylamino)-4-(phenylamino)anthracene-9,10-dione, 98%, 98%, C.I. Solvent blue 19, 5 g. Offered by: Roth, AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 50g, 25mg, 100mg.
1-anilino-4-(methylamino)anthracene-9,10-dione (CAS 12769-16-3) is a chemical compound with the molecular formula C21H16N2O2 and a molecular weight of 328.4 g/mol. IUPAC name: 1-anilino-4-(methylamino)anthracene-9,10-dione. InChIKey: TVBNRFCUTVWHQB-UHFFFAOYSA-N.
| Molecular formula | C21H16N2O2 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 1-anilino-4-(methylamino)anthracene-9,10-dione |
| InChIKey | TVBNRFCUTVWHQB-UHFFFAOYSA-N |
| SMILES | CNC1=C2C(=C(C=C1)NC3=CC=CC=C3)C(=O)C4=CC=CC=C4C2=O |
Computed by PubChem (NCBI)