Products 1020252-24-7
CAS 1020252-24-7 is the registry number for 3-((4-aminophenyl)amino)-5-methylcyclohex-2-en-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
3-(4-aminoanilino)-5-methylcyclohex-2-en-1-one (CAS 1020252-24-7) is a chemical compound with the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. IUPAC name: 3-(4-aminoanilino)-5-methylcyclohex-2-en-1-one. InChIKey: UTZLKUALGLNGES-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | 3-(4-aminoanilino)-5-methylcyclohex-2-en-1-one |
| InChIKey | UTZLKUALGLNGES-UHFFFAOYSA-N |
| SMILES | CC1CC(=CC(=O)C1)NC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)