Products 1020252-47-4
CAS 1020252-47-4 is the registry number for 1-(4-bromophenyl)-2-methyl-2-(1,2,4-triazolyl)propan-1-one. Offered by: Biosynth. Available pack sizes: 10g, 25g.
1-(4-bromophenyl)-2-methyl-2-(1,2,4-triazol-1-yl)propan-1-one (CAS 1020252-47-4) is a chemical compound with the molecular formula C12H12BrN3O and a molecular weight of 294.15 g/mol. IUPAC name: 1-(4-bromophenyl)-2-methyl-2-(1,2,4-triazol-1-yl)propan-1-one. InChIKey: WQGAEBKFSUUNHZ-UHFFFAOYSA-N.
| Molecular formula | C12H12BrN3O |
|---|---|
| Molecular weight | 294.15 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2-methyl-2-(1,2,4-triazol-1-yl)propan-1-one |
| InChIKey | WQGAEBKFSUUNHZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)C1=CC=C(C=C1)Br)N2C=NC=N2 |
Computed by PubChem (NCBI)