CAS 1020252-53-2 is the registry number for 3-(4-methylphenyl)-1-phenylindeno(2,3-d)pyrazol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
3-(4-methylphenyl)-1-phenylindeno[2,1-d]pyrazol-4-one (CAS 1020252-53-2) is a chemical compound with the molecular formula C23H16N2O and a molecular weight of 336.4 g/mol. IUPAC name: 3-(4-methylphenyl)-1-phenylindeno[2,1-d]pyrazol-4-one. InChIKey: QNWYOLGAFPJQCK-UHFFFAOYSA-N.
| Molecular formula | C23H16N2O |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 3-(4-methylphenyl)-1-phenylindeno[2,1-d]pyrazol-4-one |
| InChIKey | QNWYOLGAFPJQCK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NN(C3=C2C(=O)C4=CC=CC=C43)C5=CC=CC=C5 |
Computed by PubChem (NCBI)