CAS 1826129-73-0 is the registry number for Poly((9,9-dihexylfluoren-2,7-diyl)-co-(9-ethylcarbazol-2,7-diyl))end capped with dimethylphenyl. Offered by: Lumtec. Available pack sizes: On request.
10-(4-pyridin-4-ylphenyl)phenoxazine (CAS 1826129-73-0) is a chemical compound with the molecular formula C23H16N2O and a molecular weight of 336.4 g/mol. IUPAC name: 10-(4-pyridin-4-ylphenyl)phenoxazine. InChIKey: LCIYIELMJRWHHJ-UHFFFAOYSA-N.
| Molecular formula | C23H16N2O |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | 10-(4-pyridin-4-ylphenyl)phenoxazine |
| InChIKey | LCIYIELMJRWHHJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C3=CC=CC=C3O2)C4=CC=C(C=C4)C5=CC=NC=C5 |
Computed by PubChem (NCBI)