CAS 1020252-72-5 is the registry number for 2-(2,2-dimethylpropanoyl)-3-(4-phenylpiperazinyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg.
(2Z)-4,4-dimethyl-3-oxo-2-[(4-phenylpiperazin-1-yl)methylidene]pentanenitrile (CAS 1020252-72-5) is a chemical compound with the molecular formula C18H23N3O and a molecular weight of 297.4 g/mol. IUPAC name: (2Z)-4,4-dimethyl-3-oxo-2-[(4-phenylpiperazin-1-yl)methylidene]pentanenitrile. InChIKey: VJGONQMEEXXWOS-PFONDFGASA-N.
| Molecular formula | C18H23N3O |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | (2Z)-4,4-dimethyl-3-oxo-2-[(4-phenylpiperazin-1-yl)methylidene]pentanenitrile |
| InChIKey | VJGONQMEEXXWOS-PFONDFGASA-N |
| SMILES | CC(C)(C)C(=O)/C(=C\N1CCN(CC1)C2=CC=CC=C2)/C#N |
Computed by PubChem (NCBI)