Products 1309283-19-9
CAS 1309283-19-9 is the registry number for Despropyl disopyramide-d5. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2,3,4,5,6-pentadeuteriophenyl)-4-(propan-2-ylamino)-2-pyridin-2-ylbutanamide (CAS 1309283-19-9) is a chemical compound with the molecular formula C18H23N3O and a molecular weight of 302.4 g/mol. IUPAC name: 2-(2,3,4,5,6-pentadeuteriophenyl)-4-(propan-2-ylamino)-2-pyridin-2-ylbutanamide. InChIKey: UWNSWIXIVDMCHZ-YQYLVRRTSA-N.
| Molecular formula | C18H23N3O |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 2-(2,3,4,5,6-pentadeuteriophenyl)-4-(propan-2-ylamino)-2-pyridin-2-ylbutanamide |
| InChIKey | UWNSWIXIVDMCHZ-YQYLVRRTSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(CCNC(C)C)(C2=CC=CC=N2)C(=O)N)[2H])[2H] |
Computed by PubChem (NCBI)