CAS 1020252-77-0 appears in our catalog under these names: N-Isopropyl 4-bromo-3-methylbenzamide, 96%, N-Isopropyl 4-bromo-3-methylbenzamide. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 25g, 10g, 100g, 5g.
4-bromo-3-methyl-N-propan-2-ylbenzamide (CAS 1020252-77-0) is a chemical compound with the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. IUPAC name: 4-bromo-3-methyl-N-propan-2-ylbenzamide. InChIKey: SBUOCIGDCALEAR-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO |
|---|---|
| Molecular weight | 256.14 g/mol |
| IUPAC name | 4-bromo-3-methyl-N-propan-2-ylbenzamide |
| InChIKey | SBUOCIGDCALEAR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)NC(C)C)Br |
Computed by PubChem (NCBI)