Products 1020718-93-7
CAS 1020718-93-7 appears in our catalog under these names: 3-Aminobiphenyl-d9, >95% (HPLC), 3–Aminobiphenyl–d9, 3-Aminobiphenyl-d9. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 5mg, 2.5 mg.
2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)aniline (CAS 1020718-93-7) is a chemical compound with the molecular formula C12H11N and a molecular weight of 178.28 g/mol. IUPAC name: 2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)aniline. InChIKey: MUNOBADFTHUUFG-LOIXRAQWSA-N.
| Molecular formula | C12H11N |
|---|---|
| Molecular weight | 178.28 g/mol |
| IUPAC name | 2,3,4,6-tetradeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)aniline |
| InChIKey | MUNOBADFTHUUFG-LOIXRAQWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(=C(C(=C2[2H])[2H])[2H])N)[2H])[2H])[2H] |
Computed by PubChem (NCBI)