CAS 2243-47-2 appears in our catalog under these names: 3-Aminobiphenyl, >95% (HPLC), 3-Aminobiphenyl, 3–Aminobiphenyl, 3-Aminobiphenyl, 98%, 3-Aminobiphenyl, >99.0%(GC)(T). Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Biosynth, Thermo Scientific (Acros). Available pack sizes: 10g, 1g, 2,5g, 100mg, 1ml, 0,1kg, 0,05kg, 5g.
3-phenylaniline (CAS 2243-47-2) is a chemical compound with the molecular formula C12H11N and a molecular weight of 169.22 g/mol. IUPAC name: 3-phenylaniline. InChIKey: MUNOBADFTHUUFG-UHFFFAOYSA-N.
| Molecular formula | C12H11N |
|---|---|
| Molecular weight | 169.22 g/mol |
| IUPAC name | 3-phenylaniline |
| InChIKey | MUNOBADFTHUUFG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)