Products 1020719-23-6
CAS 1020719-23-6 is the registry number for 2-Butyne-1,4-diol-(1,1,4,4)-d4, Diacetate. Offered by: TRC. Available pack sizes: 100mg, 10mg.
(4-acetyloxy-1,1,4,4-tetradeuteriobut-2-ynyl) acetate (CAS 1020719-23-6) is a chemical compound with the molecular formula C8H10O4 and a molecular weight of 174.19 g/mol. IUPAC name: (4-acetyloxy-1,1,4,4-tetradeuteriobut-2-ynyl) acetate. InChIKey: TVIMIQVBDDNCCR-NZLXMSDQSA-N.
| Molecular formula | C8H10O4 |
|---|---|
| Molecular weight | 174.19 g/mol |
| IUPAC name | (4-acetyloxy-1,1,4,4-tetradeuteriobut-2-ynyl) acetate |
| InChIKey | TVIMIQVBDDNCCR-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(C#CC([2H])([2H])OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)