CAS 1020719-35-0 appears in our catalog under these names: D,L-O-Desmethyl Venlafaxine-d6, >95% (HPLC), D,L-O-Desmethyl Venlafaxine-d6 (100 μg/mL in Methanol). Offered by: TRC. Available pack sizes: 10mg, 1mg, 1x1ml.
3,3,4,4,5,5-hexadeuterio-1-[2-(dimethylamino)-1-(4-hydroxyphenyl)ethyl]cyclohexan-1-ol (CAS 1020719-35-0) is a chemical compound with the molecular formula C16H25NO2 and a molecular weight of 269.41 g/mol. IUPAC name: 3,3,4,4,5,5-hexadeuterio-1-[2-(dimethylamino)-1-(4-hydroxyphenyl)ethyl]cyclohexan-1-ol. InChIKey: KYYIDSXMWOZKMP-RUJHVMJGSA-N.
| Molecular formula | C16H25NO2 |
|---|---|
| Molecular weight | 269.41 g/mol |
| IUPAC name | 3,3,4,4,5,5-hexadeuterio-1-[2-(dimethylamino)-1-(4-hydroxyphenyl)ethyl]cyclohexan-1-ol |
| InChIKey | KYYIDSXMWOZKMP-RUJHVMJGSA-N |
| SMILES | [2H]C1(CC(CC(C1([2H])[2H])([2H])[2H])(C(CN(C)C)C2=CC=C(C=C2)O)O)[2H] |
Computed by PubChem (NCBI)