CAS 142761-11-3 appears in our catalog under these names: R-O-Desmethyl-Venlafaxine, Desvenlafaxine R-Isomer, Desvenlafaxine Impurity 1(R-Isomer), R-(-)-O-Desmethyl Venlafaxine, >95% (HPLC), 4-(2-(Dimethylamino)-1-(1-hydroxycyclohexyl)ethyl)phenol. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 250mg.
4-[(1R)-2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol (CAS 142761-11-3) is a chemical compound with the molecular formula C16H25NO2 and a molecular weight of 263.37 g/mol. IUPAC name: 4-[(1R)-2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol. InChIKey: KYYIDSXMWOZKMP-HNNXBMFYSA-N.
| Molecular formula | C16H25NO2 |
|---|---|
| Molecular weight | 263.37 g/mol |
| IUPAC name | 4-[(1R)-2-(dimethylamino)-1-(1-hydroxycyclohexyl)ethyl]phenol |
| InChIKey | KYYIDSXMWOZKMP-HNNXBMFYSA-N |
| SMILES | CN(C)C[C@@H](C1=CC=C(C=C1)O)C2(CCCCC2)O |
Computed by PubChem (NCBI)