CAS 1020719-54-3 appears in our catalog under these names: 9-(2-(Hydroxypropyl-d6) Adenine, 9-(2-Hydroxypropyl)adenine-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
(2S)-1-(6-aminopurin-9-yl)-1,1,2,3,3,3-hexadeuteriopropan-2-ol (CAS 1020719-54-3) is a chemical compound with the molecular formula C8H11N5O and a molecular weight of 199.24 g/mol. IUPAC name: (2S)-1-(6-aminopurin-9-yl)-1,1,2,3,3,3-hexadeuteriopropan-2-ol. InChIKey: MJZYTEBKXLVLMY-BWBMVNDDSA-N.
| Molecular formula | C8H11N5O |
|---|---|
| Molecular weight | 199.24 g/mol |
| IUPAC name | (2S)-1-(6-aminopurin-9-yl)-1,1,2,3,3,3-hexadeuteriopropan-2-ol |
| InChIKey | MJZYTEBKXLVLMY-BWBMVNDDSA-N |
| SMILES | [2H][C@](C([2H])([2H])[2H])(C([2H])([2H])N1C=NC2=C(N=CN=C21)N)O |
Computed by PubChem (NCBI)