CAS 36817-69-3 appears in our catalog under these names: (R)-2-(6-Amino-9H-purin-9-yl)propan-1-ol, 98%, Tenofovir Impurity 151, Tenofovir Impurity 70, Tenofovir Impurity 109. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2R)-2-(6-aminopurin-9-yl)propan-1-ol (CAS 36817-69-3) is a chemical compound with the molecular formula C8H11N5O and a molecular weight of 193.21 g/mol. IUPAC name: (2R)-2-(6-aminopurin-9-yl)propan-1-ol. InChIKey: NMBLSWKTQBVMBR-RXMQYKEDSA-N.
| Molecular formula | C8H11N5O |
|---|---|
| Molecular weight | 193.21 g/mol |
| IUPAC name | (2R)-2-(6-aminopurin-9-yl)propan-1-ol |
| InChIKey | NMBLSWKTQBVMBR-RXMQYKEDSA-N |
| SMILES | C[C@H](CO)N1C=NC2=C(N=CN=C21)N |
Computed by PubChem (NCBI)