CAS 1020719-62-3 appears in our catalog under these names: Pirfenidone-d5, 5-Methyl-N-phenyl-2-1H-pyridone-d5 ( Pirfenidone-d5 ), >95% (HPLC), Pirfenidone–d5, Pirfenidone-d5, 98.88%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 5 mg, 10 mg, 1 mg.
5-methyl-1-(2,3,4,5,6-pentadeuteriophenyl)pyridin-2-one (CAS 1020719-62-3) is a chemical compound with the molecular formula C12H11NO and a molecular weight of 190.25 g/mol. IUPAC name: 5-methyl-1-(2,3,4,5,6-pentadeuteriophenyl)pyridin-2-one. InChIKey: ISWRGOKTTBVCFA-VIQYUKPQSA-N.
| Molecular formula | C12H11NO |
|---|---|
| Molecular weight | 190.25 g/mol |
| IUPAC name | 5-methyl-1-(2,3,4,5,6-pentadeuteriophenyl)pyridin-2-one |
| InChIKey | ISWRGOKTTBVCFA-VIQYUKPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])N2C=C(C=CC2=O)C)[2H])[2H] |
Computed by PubChem (NCBI)