CAS 1020719-70-3 appears in our catalog under these names: (R,S)-Norcotinine-pyridyl-d4, >95% (HPLC), Norcotinine–d4, (R,S)-Norcotinine-d4. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
5-(2,4,5,6-tetradeuterio-3-pyridinyl)pyrrolidin-2-one (CAS 1020719-70-3) is a chemical compound with the molecular formula C9H10N2O and a molecular weight of 166.21 g/mol. IUPAC name: 5-(2,4,5,6-tetradeuterio-3-pyridinyl)pyrrolidin-2-one. InChIKey: FXFANIORDKRCCA-NMRLXUNGSA-N.
| Molecular formula | C9H10N2O |
|---|---|
| Molecular weight | 166.21 g/mol |
| IUPAC name | 5-(2,4,5,6-tetradeuterio-3-pyridinyl)pyrrolidin-2-one |
| InChIKey | FXFANIORDKRCCA-NMRLXUNGSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])C2CCC(=O)N2)[2H] |
Computed by PubChem (NCBI)