Products 2483736-11-2
CAS 2483736-11-2 is the registry number for (R,S)-Norcotinine-13C3. Offered by: TRC. Available pack sizes: 25mg.
5-pyridin-3-yl(2,3,4-13C3)azolidin-2-one (CAS 2483736-11-2) is a chemical compound with the molecular formula C9H10N2O and a molecular weight of 165.17 g/mol. IUPAC name: 5-pyridin-3-yl(2,3,4-13C3)azolidin-2-one. InChIKey: FXFANIORDKRCCA-KNQIATALSA-N.
| Molecular formula | C9H10N2O |
|---|---|
| Molecular weight | 165.17 g/mol |
| IUPAC name | 5-pyridin-3-yl(2,3,4-13C3)azolidin-2-one |
| InChIKey | FXFANIORDKRCCA-KNQIATALSA-N |
| SMILES | [13CH2]1[13CH2][13C](=O)NC1C2=CN=CC=C2 |
Computed by PubChem (NCBI)