CAS 1020719-96-3 appears in our catalog under these names: 1,2,3,6-Tetrahydrophthalimide-3,3,4,5,6,6-d6, >95% (HPLC), 3a,4,7,7a-Tetrahydro-1H-isoindole-1,3(2H)-dione-d6, D6-cis-1,2,3,6-Tetrahydrophthalimide. Offered by: TRC, MedChemExpress, HPC Standards. Available pack sizes: 100mg, 10mg, 100 mg, 10 mg, 1x10mg.
4,4,5,6,7,7-hexadeuterio-3a,7a-dihydroisoindole-1,3-dione (CAS 1020719-96-3) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 157.20 g/mol. IUPAC name: 4,4,5,6,7,7-hexadeuterio-3a,7a-dihydroisoindole-1,3-dione. InChIKey: CIFFBTOJCKSRJY-TZCZJOIZSA-N.
| Molecular formula | C8H9NO2 |
|---|---|
| Molecular weight | 157.20 g/mol |
| IUPAC name | 4,4,5,6,7,7-hexadeuterio-3a,7a-dihydroisoindole-1,3-dione |
| InChIKey | CIFFBTOJCKSRJY-TZCZJOIZSA-N |
| SMILES | [2H]C1=C(C(C2C(C1([2H])[2H])C(=O)NC2=O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)