Products 203578-24-9
CAS 203578-24-9 appears in our catalog under these names: cis-1,2,3,6-Tetrahydrophthalimide D6 (3,3,4,5,6,6-D6), cis-1,2,3,6-Tetrahydrophthalimide-3,3,4,5,6,6-d6, 98 atom % D, min 98% Chemical Purity, cis-1,2,3,6-Tetrahydrophthalimide-3,3,4,5,6,6-d6, >95% (HPLC), rel-3a,4,7,7a-Tetrahydro-1H-isoindole-1,3(2H)-dione-d6, 99.40%. Offered by: Dr. Ehrenstorfer, CDN, TRC, MedChemExpress. Available pack sizes: 10mg, 0,1g, 0,05g, 1mg, 2mg, 10 mg.
(3aR,7aS)-4,4,5,6,7,7-hexadeuterio-3a,7a-dihydroisoindole-1,3-dione (CAS 203578-24-9) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 157.20 g/mol. IUPAC name: (3aR,7aS)-4,4,5,6,7,7-hexadeuterio-3a,7a-dihydroisoindole-1,3-dione. InChIKey: CIFFBTOJCKSRJY-BCANURTISA-N.
| Molecular formula | C8H9NO2 |
|---|---|
| Molecular weight | 157.20 g/mol |
| IUPAC name | (3aR,7aS)-4,4,5,6,7,7-hexadeuterio-3a,7a-dihydroisoindole-1,3-dione |
| InChIKey | CIFFBTOJCKSRJY-BCANURTISA-N |
| SMILES | [2H]C1=C(C([C@H]2[C@@H](C1([2H])[2H])C(=O)NC2=O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)