Products 1020814-70-3
CAS 1020814-70-3 is the registry number for RO 5073012. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-chloro-N-(1H-imidazol-5-ylmethyl)-N-propan-2-ylaniline (CAS 1020814-70-3) is a chemical compound with the molecular formula C13H16ClN3 and a molecular weight of 249.74 g/mol. IUPAC name: 4-chloro-N-(1H-imidazol-5-ylmethyl)-N-propan-2-ylaniline. InChIKey: AOHLEOYTKMSKPD-UHFFFAOYSA-N.
| Molecular formula | C13H16ClN3 |
|---|---|
| Molecular weight | 249.74 g/mol |
| IUPAC name | 4-chloro-N-(1H-imidazol-5-ylmethyl)-N-propan-2-ylaniline |
| InChIKey | AOHLEOYTKMSKPD-UHFFFAOYSA-N |
| SMILES | CC(C)N(CC1=CN=CN1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)