Products 1020929-58-1
CAS 1020929-58-1 is the registry number for (2-Chlorophenyl)(2,3-dihydro-1-benzofuran-5-yl)methanamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2-chlorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanamine (CAS 1020929-58-1) is a chemical compound with the molecular formula C15H14ClNO and a molecular weight of 259.73 g/mol. IUPAC name: (2-chlorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanamine. InChIKey: JWINCZBVUPPUFG-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO |
|---|---|
| Molecular weight | 259.73 g/mol |
| IUPAC name | (2-chlorophenyl)-(2,3-dihydro-1-benzofuran-5-yl)methanamine |
| InChIKey | JWINCZBVUPPUFG-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)C(C3=CC=CC=C3Cl)N |
Computed by PubChem (NCBI)