Products 1020945-92-9
CAS 1020945-92-9 appears in our catalog under these names: 3-Chloro-6-ethoxypyridine-2-carboxylic acid, 3-Chloro-6-ethoxypyridine-2-carboxylic acid 95%, 3-Chloro-6-ethoxypyridine-2-carboxylic acid, 95%, 95%, 3-Chloro-6-ethoxypyridine-2-carboxylic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
3-chloro-6-ethoxypyridine-2-carboxylic acid (CAS 1020945-92-9) is a chemical compound with the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. IUPAC name: 3-chloro-6-ethoxypyridine-2-carboxylic acid. InChIKey: GOTHCMYEHRDTBZ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 3-chloro-6-ethoxypyridine-2-carboxylic acid |
| InChIKey | GOTHCMYEHRDTBZ-UHFFFAOYSA-N |
| SMILES | CCOC1=NC(=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)