CAS 1021022-20-7 is the registry number for 3-{((4-Fluoro-2-methylphenyl)amino)methyl}benzonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
3-[(4-fluoro-2-methylanilino)methyl]benzonitrile (CAS 1021022-20-7) is a chemical compound with the molecular formula C15H13FN2 and a molecular weight of 240.27 g/mol. IUPAC name: 3-[(4-fluoro-2-methylanilino)methyl]benzonitrile. InChIKey: LLXGTNPRSOJPRY-UHFFFAOYSA-N.
| Molecular formula | C15H13FN2 |
|---|---|
| Molecular weight | 240.27 g/mol |
| IUPAC name | 3-[(4-fluoro-2-methylanilino)methyl]benzonitrile |
| InChIKey | LLXGTNPRSOJPRY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)NCC2=CC(=CC=C2)C#N |
Computed by PubChem (NCBI)