CAS 1021080-21-6 appears in our catalog under these names: 4-([(4-Fluoro-2-methylphenyl)amino]methyl)benzonitrile, 95%, 4-{((4-fluoro-2-methylphenyl)amino)methyl}benzonitrile, 95%, 4-{((4-Fluoro-2-methylphenyl)amino)methyl}benzonitrile. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-[(4-fluoro-2-methylanilino)methyl]benzonitrile (CAS 1021080-21-6) is a chemical compound with the molecular formula C15H13FN2 and a molecular weight of 240.27 g/mol. IUPAC name: 4-[(4-fluoro-2-methylanilino)methyl]benzonitrile. InChIKey: WRPQQMPISWUHRN-UHFFFAOYSA-N.
| Molecular formula | C15H13FN2 |
|---|---|
| Molecular weight | 240.27 g/mol |
| IUPAC name | 4-[(4-fluoro-2-methylanilino)methyl]benzonitrile |
| InChIKey | WRPQQMPISWUHRN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)NCC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)