CAS 1021063-95-5 appears in our catalog under these names: (3-(2,2,2-Trifluoroethoxy)phenyl)methanol, 95%, (3-(2,2,2-Trifluoroethoxy)phenyl)methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
[3-(2,2,2-trifluoroethoxy)phenyl]methanol (CAS 1021063-95-5) is a chemical compound with the molecular formula C9H9F3O2 and a molecular weight of 206.16 g/mol. IUPAC name: [3-(2,2,2-trifluoroethoxy)phenyl]methanol. InChIKey: VIVCPZPHCLORGC-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O2 |
|---|---|
| Molecular weight | 206.16 g/mol |
| IUPAC name | [3-(2,2,2-trifluoroethoxy)phenyl]methanol |
| InChIKey | VIVCPZPHCLORGC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(F)(F)F)CO |
Computed by PubChem (NCBI)