CAS 1021117-39-4 is the registry number for (3–(4–Fluorobenzyl)–2,4–dioxo–1,3,8–triazaspiro(4·5)dec–8–yl)acetic acid. Offered by: GLPBio. Available pack sizes: 1g, 2,5g.
2-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]acetic acid (CAS 1021117-39-4) is a chemical compound with the molecular formula C16H18FN3O4 and a molecular weight of 335.33 g/mol. IUPAC name: 2-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]acetic acid. InChIKey: DSNKHNLNWSSZKH-UHFFFAOYSA-N.
| Molecular formula | C16H18FN3O4 |
|---|---|
| Molecular weight | 335.33 g/mol |
| IUPAC name | 2-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl]acetic acid |
| InChIKey | DSNKHNLNWSSZKH-UHFFFAOYSA-N |
| SMILES | C1CN(CCC12C(=O)N(C(=O)N2)CC3=CC=C(C=C3)F)CC(=O)O |
Computed by PubChem (NCBI)