Products 1021140-25-9
CAS 1021140-25-9 is the registry number for 4-Chloro-2-(((3-fluoro-4-methylphenyl)amino)methyl)phenol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-2-[(3-fluoro-4-methylanilino)methyl]phenol (CAS 1021140-25-9) is a chemical compound with the molecular formula C14H13ClFNO and a molecular weight of 265.71 g/mol. IUPAC name: 4-chloro-2-[(3-fluoro-4-methylanilino)methyl]phenol. InChIKey: PTLJXZJCXNUQAZ-UHFFFAOYSA-N.
| Molecular formula | C14H13ClFNO |
|---|---|
| Molecular weight | 265.71 g/mol |
| IUPAC name | 4-chloro-2-[(3-fluoro-4-methylanilino)methyl]phenol |
| InChIKey | PTLJXZJCXNUQAZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NCC2=C(C=CC(=C2)Cl)O)F |
Computed by PubChem (NCBI)