Products 477848-49-0
CAS 477848-49-0 is the registry number for 2-[(Z)-(2-Chloro-6-fluorophenyl)methylidene]-3-quinuclidinone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one (CAS 477848-49-0) is a chemical compound with the molecular formula C14H13ClFNO and a molecular weight of 265.71 g/mol. IUPAC name: (2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one. InChIKey: ROIJUVPXPUJUTH-JYRVWZFOSA-N.
| Molecular formula | C14H13ClFNO |
|---|---|
| Molecular weight | 265.71 g/mol |
| IUPAC name | (2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one |
| InChIKey | ROIJUVPXPUJUTH-JYRVWZFOSA-N |
| SMILES | C1CN\2CCC1C(=O)/C2=C/C3=C(C=CC=C3Cl)F |
Computed by PubChem (NCBI)