Products 1021221-94-2
CAS 1021221-94-2 is the registry number for NS2B/NS3-IN-8, 98.0%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 25 mg, 10 mg, 50 mg.
N-(5,7-dimethyl-[1,3]thiazolo[4,5-b]pyridin-2-yl)-1-benzofuran-2-carboxamide (CAS 1021221-94-2) is a chemical compound with the molecular formula C17H13N3O2S and a molecular weight of 323.4 g/mol. IUPAC name: N-(5,7-dimethyl-[1,3]thiazolo[4,5-b]pyridin-2-yl)-1-benzofuran-2-carboxamide. InChIKey: MIATZSYTBCVGSR-UHFFFAOYSA-N.
| Molecular formula | C17H13N3O2S |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | N-(5,7-dimethyl-[1,3]thiazolo[4,5-b]pyridin-2-yl)-1-benzofuran-2-carboxamide |
| InChIKey | MIATZSYTBCVGSR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1SC(=N2)NC(=O)C3=CC4=CC=CC=C4O3)C |
Computed by PubChem (NCBI)