CAS 1023536-43-7 is the registry number for N,N-dimethyl(4-oxo-3-(2-thienyl)indeno(2,3-d)pyrazolyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N,N-dimethyl-4-oxo-3-thiophen-2-ylindeno[2,1-d]pyrazole-1-carboxamide (CAS 1023536-43-7) is a chemical compound with the molecular formula C17H13N3O2S and a molecular weight of 323.4 g/mol. IUPAC name: N,N-dimethyl-4-oxo-3-thiophen-2-ylindeno[2,1-d]pyrazole-1-carboxamide. InChIKey: FHQLKIMKSYUOPJ-UHFFFAOYSA-N.
| Molecular formula | C17H13N3O2S |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | N,N-dimethyl-4-oxo-3-thiophen-2-ylindeno[2,1-d]pyrazole-1-carboxamide |
| InChIKey | FHQLKIMKSYUOPJ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)N1C2=C(C(=N1)C3=CC=CS3)C(=O)C4=CC=CC=C42 |
Computed by PubChem (NCBI)