CAS 102126-70-5 appears in our catalog under these names: 3,5-dibromo-1,3-dihydro-2-benzofuran-1-one, 98%, 98%, 3,5-Dibromoisobenzofuran-1(3H)-one, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
3,5-dibromo-3H-2-benzofuran-1-one (CAS 102126-70-5) is a chemical compound with the molecular formula C8H4Br2O2 and a molecular weight of 291.92 g/mol. IUPAC name: 3,5-dibromo-3H-2-benzofuran-1-one. InChIKey: AVHYDEJTOWNHJV-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2O2 |
|---|---|
| Molecular weight | 291.92 g/mol |
| IUPAC name | 3,5-dibromo-3H-2-benzofuran-1-one |
| InChIKey | AVHYDEJTOWNHJV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(OC2=O)Br |
Computed by PubChem (NCBI)