Products 102130-91-6
CAS 102130-91-6 appears in our catalog under these names: Neoprocurcumenol, Neoprocurcumenol, ≥95%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 5 mg, 1 mg.
(3S,3aS)-3-hydroxy-3,8-dimethyl-5-propan-2-ylidene-2,3a,4,7-tetrahydro-1H-azulen-6-one (CAS 102130-91-6) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: (3S,3aS)-3-hydroxy-3,8-dimethyl-5-propan-2-ylidene-2,3a,4,7-tetrahydro-1H-azulen-6-one. InChIKey: DAUDFKSHOYLOOB-ZFWWWQNUSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | (3S,3aS)-3-hydroxy-3,8-dimethyl-5-propan-2-ylidene-2,3a,4,7-tetrahydro-1H-azulen-6-one |
| InChIKey | DAUDFKSHOYLOOB-ZFWWWQNUSA-N |
| SMILES | CC1=C2CC[C@]([C@H]2CC(=C(C)C)C(=O)C1)(C)O |
Computed by PubChem (NCBI)
Synonyms:
Neoprocurcumenol, orb1682029